4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropylamine (1:2) structure
|
Common Name | 4,4'-methylenebis[3-hydroxy-2-naphthoic] acid, compound with 3-(10,11-dihydro-5H-dibenzo[a,d]cyclohepten-5-ylidene)-N,N-dimethylpropylamine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 17086-03-2 | Molecular Weight | 665.77300 | |
| Density | N/A | Boiling Point | 642.7ºC at 760 mmHg | |
| Molecular Formula | C43H39NO6 | Melting Point | 196-197ºC | |
| MSDS | N/A | Flash Point | 356.5ºC | |
| Name | 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylic acid,3-(5,6-dihydrodibenzo[2,1-b:2',1'-f][7]annulen-11-ylidene)-N,N-dimethylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 642.7ºC at 760 mmHg |
|---|---|
| Melting Point | 196-197ºC |
| Molecular Formula | C43H39NO6 |
| Molecular Weight | 665.77300 |
| Flash Point | 356.5ºC |
| Exact Mass | 665.27800 |
| PSA | 118.30000 |
| LogP | 8.56000 |
| Vapour Pressure | 2.13E-17mmHg at 25°C |
| InChIKey | FRYYNPIESGDSLC-UHFFFAOYSA-N |
| SMILES | CN(C)CCC=C1c2ccccc2CCc2ccccc21.O=C(O)c1cc2ccccc2c(Cc2c(O)c(C(=O)O)cc3ccccc23)c1O |
| Embonato de amitriptilina |
| Amitriptyline embonate |
| 4,4'-Methylenebis(3-hydroxy-2-naphthoic) acid,compound with 3-(10,11-dihydro-5H-dibenzo(a,d)cyclohepten-5-ylidene)-N,N-dimethylpropylamine (1:2) |
| EINECS 241-145-1 |