5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione structure
|
Common Name | 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 1708811-76-0 | Molecular Weight | 236.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H16N2O3 |
|---|---|
| Molecular Weight | 236.27 |
| InChIKey | NPTIPSRCUQAFTM-UHFFFAOYSA-N |
| SMILES | COc1c(C2CC(=O)CC(=O)C2)c(C)nn1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione? |
| A: InChIKey of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione is NPTIPSRCUQAFTM-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione? |
| A: SMILES notation of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione is COc1c(C2CC(=O)CC(=O)C2)c(C)nn1C. |
| Q: What is the CAS number of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione? |
| A: CAS number of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione is 1708811-76-0. |
| Q: What is the molecular weight of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione? |
| A: Molecular weight of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione is 236.27. |
| Q: What is the English name of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione? |
| A: The English name of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione is 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione. |
| Q: What is the molecular formula of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione? |
| A: Molecular formula of 5-(5-Methoxy-1,3-dimethyl-1H-pyrazol-4-yl)cyclohexane-1,3-dione is C12H16N2O3. |
| Q: What is the Chinese name of 1708811-76-0? |
| A: Chinese name of 1708811-76-0 is 1708811-76-0. |