3-O-sulfogalactose structure
|
Common Name | 3-O-sulfogalactose | ||
|---|---|---|---|---|
| CAS Number | 17112-77-5 | Molecular Weight | 260.21900 | |
| Density | 1.841g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C6H12O9S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [(2R,3S,4S,5R)-2,4,5,6-tetrahydroxy-1-oxohexan-3-yl] hydrogen sulfate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.841g/cm3 |
|---|---|
| Molecular Formula | C6H12O9S |
| Molecular Weight | 260.21900 |
| Exact Mass | 260.02000 |
| PSA | 169.97000 |
| Index of Refraction | 1.599 |
| InChIKey | XBAAKGHPVXQWEM-DPYQTVNSSA-N |
| SMILES | O=CC(O)C(OS(=O)(=O)O)C(O)C(O)CO |
| HS Code | 2914400090 |
|---|
|
~%
3-O-sulfogalactose CAS#:17112-77-5 |
| Literature: Turvey,J.R.; Williams,T.P. Journal of the Chemical Society, 1963 , p. 2242 - 2246 |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-O-Sulfogalactose |
| galactose-3-O-sulfate |
| D-Galactose 3-sulfate |
| O3-sulfo-D-galactose |
| Galactose-3-sulfate |