6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine
Modify Date: 2025-09-09 14:13:13
![6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine Structure](https://www.chemsrc.com/extcaspic/196/1712038-61-3.png)
6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine structure
|
Common Name | 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine | ||
|---|---|---|---|---|
| CAS Number | 1712038-61-3 | Molecular Weight | 235.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H21N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H21N5 |
|---|---|
| Molecular Weight | 235.33 |
| InChIKey | XRCFGIIIARINFZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)N1CCN(c2ccc(N)nn2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine? |
| A: CAS number of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine is 1712038-61-3. |
| Q: What is the InChIKey of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine? |
| A: InChIKey of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine is XRCFGIIIARINFZ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine? |
| A: SMILES notation of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine is CC(C)(C)N1CCN(c2ccc(N)nn2)CC1. |
| Q: What is the molecular weight of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine? |
| A: Molecular weight of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine is 235.33. |
| Q: What is the Chinese name of 1712038-61-3? |
| A: Chinese name of 1712038-61-3 is 1712038-61-3. |
| Q: What is the molecular formula of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine? |
| A: Molecular formula of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine is C12H21N5. |
| Q: What is the English name of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine? |
| A: The English name of 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine is 6-[4-(1,1-Dimethylethyl)-1-piperazinyl]-3-pyridazinamine. |