cyclohexyl diphenyl phosphite structure
|
Common Name | cyclohexyl diphenyl phosphite | ||
|---|---|---|---|---|
| CAS Number | 17124-06-0 | Molecular Weight | 316.33100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H21O3P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | cyclohexyl diphenyl phosphite |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H21O3P |
|---|---|
| Molecular Weight | 316.33100 |
| Exact Mass | 316.12300 |
| PSA | 41.28000 |
| LogP | 5.72060 |
| InChIKey | KFYNLYOAEZCCAN-UHFFFAOYSA-N |
| SMILES | c1ccc(OP(Oc2ccccc2)OC2CCCCC2)cc1 |
|
~%
cyclohexyl diph... CAS#:17124-06-0 |
| Literature: Forsman; Lipkin Journal of the American Chemical Society, 1953 , vol. 75, p. 3145,3146 |
| phosphorous acid cyclohexyl ester-diphenyl ester |
| Phosphorous acid,cyclohexyl diphenyl ester |
| Phosphorigsaeure-cyclohexylester-diphenylester |