3-oxo-3-(2-phenylethylamino)propane-1-sulfinic acid,2-phenylethanamine structure
|
Common Name | 3-oxo-3-(2-phenylethylamino)propane-1-sulfinic acid,2-phenylethanamine | ||
|---|---|---|---|---|
| CAS Number | 171359-12-9 | Molecular Weight | 362.48600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H26N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-oxo-3-(2-phenylethylamino)propane-1-sulfinic acid,2-phenylethanamine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H26N2O3S |
|---|---|
| Molecular Weight | 362.48600 |
| Exact Mass | 362.16600 |
| PSA | 115.12000 |
| LogP | 4.55120 |
| Vapour Pressure | 4.78E-18mmHg at 25°C |
| InChIKey | JKHZGDZBDSIUMA-UHFFFAOYSA-N |
| SMILES | NCCc1ccccc1.O=C(CCS(=O)O)NCCc1ccccc1 |
| 3-Oxo-3-((2-phenylethyl)amino)-1-propanesulfinic acid compd. with benzeneethanamine (1:1) |
| 3-oxo-3-(phenethylamino)propane-1-sulfinic acid |
| 1-Propanesulfinic acid,3-oxo-3-((2-phenylethyl)amino)-,compd. with benzeneethanamine (1:1) |