3-Sulfinopropanoic acid compd. with benzeneethanamine (1:2) structure
|
Common Name | 3-Sulfinopropanoic acid compd. with benzeneethanamine (1:2) | ||
|---|---|---|---|---|
| CAS Number | 171359-17-4 | Molecular Weight | 380.50200 | |
| Density | N/A | Boiling Point | 196.5ºC at 760 mmHg | |
| Molecular Formula | C19H28N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 90.6ºC | |
| Name | 2-phenylethanamine,3-sulfinopropanoic acid |
|---|
| Boiling Point | 196.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H28N2O4S |
| Molecular Weight | 380.50200 |
| Flash Point | 90.6ºC |
| Exact Mass | 380.17700 |
| PSA | 145.85000 |
| LogP | 4.32470 |
| Vapour Pressure | 0.398mmHg at 25°C |
| InChIKey | YRIRIOIZMRCSKU-UHFFFAOYSA-N |
| SMILES | NCCc1ccccc1.NCCc1ccccc1.O=C(O)CCS(=O)O |