[5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid
Modify Date: 2025-09-10 11:30:56
![[5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid Structure](https://www.chemsrc.com/extcaspic/208/1713762-64-1.png)
[5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid structure
|
Common Name | [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid | ||
|---|---|---|---|---|
| CAS Number | 1713762-64-1 | Molecular Weight | 282.36 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H18N2O3S |
|---|---|
| Molecular Weight | 282.36 |
| InChIKey | GEXYMXUDORPTSD-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc([N+](=O)[O-])c(N2CC(C)CC(C)C2)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid? |
| A: SMILES notation of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid is CC(=O)c1cc([N+](=O)[O-])c(N2CC(C)CC(C)C2)s1. |
| Q: What is the CAS number of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid? |
| A: CAS number of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid is 1713762-64-1. |
| Q: What is the English name of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid? |
| A: The English name of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid is [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid. |
| Q: What is the molecular weight of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid? |
| A: Molecular weight of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid is 282.36. |
| Q: What is the molecular formula of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid? |
| A: Molecular formula of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid is C13H18N2O3S. |
| Q: What is the Chinese name of 1713762-64-1? |
| A: Chinese name of 1713762-64-1 is 1713762-64-1. |
| Q: What is the InChIKey of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid? |
| A: InChIKey of [5-Acetyl-2-(3,5-dimethyl-1-piperidyl)-3-thienyl]azinic acid is GEXYMXUDORPTSD-UHFFFAOYSA-N. |