4,4-Dichlorobenzophenone, Oxime structure
|
Common Name | 4,4-Dichlorobenzophenone, Oxime | ||
|---|---|---|---|---|
| CAS Number | 1714-50-7 | Molecular Weight | 266.12300 | |
| Density | 1.29g/cm3 | Boiling Point | 388.4ºC at 760 mmHg | |
| Molecular Formula | C13H9Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.7ºC | |
| Name | bis(4-chlorophenyl)methanone oxime |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 388.4ºC at 760 mmHg |
| Molecular Formula | C13H9Cl2NO |
| Molecular Weight | 266.12300 |
| Flash Point | 188.7ºC |
| Exact Mass | 265.00600 |
| PSA | 32.59000 |
| LogP | 4.22000 |
| Vapour Pressure | 9.94E-07mmHg at 25°C |
| Index of Refraction | 1.601 |
| InChIKey | NAXFZIAEWOZCSH-UHFFFAOYSA-N |
| SMILES | ON=C(c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4,4'-Dichlor-benzophenon-oxim |
| bis-(4-chlorophenyl)phenylmethanone oxime |
| N-[Bis(4-chlorophenyl)methylene]hydroxylamine |
| 4,4'-Dichlorobenzophenone oxime |