5-oxoproline, compound with 2-(diethylamino)ethyl 4-aminobenzoate (1:1) structure
|
Common Name | 5-oxoproline, compound with 2-(diethylamino)ethyl 4-aminobenzoate (1:1) | ||
|---|---|---|---|---|
| CAS Number | 17140-49-7 | Molecular Weight | 379.45100 | |
| Density | N/A | Boiling Point | 633.5ºC at 760 mmHg | |
| Molecular Formula | C19H29N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 336.9ºC | |
| Name | 2-(diethylamino)ethyl 4-aminobenzoate,(2S)-5-oxopyrrolidine-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 633.5ºC at 760 mmHg |
|---|---|
| Molecular Formula | C19H29N3O5 |
| Molecular Weight | 379.45100 |
| Flash Point | 336.9ºC |
| Exact Mass | 379.21100 |
| PSA | 121.96000 |
| LogP | 2.41710 |
| Vapour Pressure | 6.41E-17mmHg at 25°C |
| InChIKey | CTURZEPMXLXYMZ-HVDRVSQOSA-N |
| SMILES | CCN(CC)CCOC(=O)c1ccc(N)cc1.O=C1CCC(C(=O)O)N1 |
| 5-Oxoproline,compound with 2-(diethylamino)ethyl 4-aminobenzoate (1:1) |
| 5-Oxo-L-prolin,Salz des 4-Amino-benzoesaeure-(2-diaethylamino-aethylesters) |
| EINECS 241-201-5 |
| 5-oxo-L-proline,salt of 4-amino-benzoic acid-(2-diethylamino-ethyl ester) |