1,3-Dioxane,2-(1-ethylpentyl)-5-methyl-5-nitro- structure
|
Common Name | 1,3-Dioxane,2-(1-ethylpentyl)-5-methyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 17144-55-7 | Molecular Weight | 245.31500 | |
| Density | 1.04g/cm3 | Boiling Point | 327.2ºC at 760mmHg | |
| Molecular Formula | C12H23NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121ºC | |
| Name | 2-heptan-3-yl-5-methyl-5-nitro-1,3-dioxane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.04g/cm3 |
|---|---|
| Boiling Point | 327.2ºC at 760mmHg |
| Molecular Formula | C12H23NO4 |
| Molecular Weight | 245.31500 |
| Flash Point | 121ºC |
| Exact Mass | 245.16300 |
| PSA | 64.28000 |
| LogP | 3.13430 |
| Vapour Pressure | 0.000205mmHg at 25°C |
| Index of Refraction | 1.467 |
| InChIKey | FCGHBWUKOGKLKO-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C1OCC(C)([N+](=O)[O-])CO1 |
|
~%
1,3-Dioxane,2-(... CAS#:17144-55-7 |
| Literature: Senkus Journal of the American Chemical Society, 1941 , vol. 63, p. 2635 Journal of the American Chemical Society, 1943 , vol. 65, p. 1656 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-Ethylhexanal ethyleneglycol cyclic acetal |
| 2-(1-Ethylpentyl)-1,3-dioxolane |
| 2-(1-Aethyl-pentyl)-[1,3]dioxolan |
| 1,3-Dioxolane,2-(1-ethylpentyl) |
| 2-(heptan-3-yl)-1,3-dioxolane |
| 2-(3-Heptyl)-1,3-dioxolane |
| 2-(1-ethyl-pentyl)-5-methyl-5-nitro-[1,3]dioxane |
| 2-(1-Aethyl-pentyl)-5-methyl-5-nitro-[1,3]dioxan |