5-(3-Hydroxybutyl)-1-phenylbarbituric acid
Modify Date: 2025-09-20 16:37:11
5-(3-Hydroxybutyl)-1-phenylbarbituric acid structure
|
Common Name | 5-(3-Hydroxybutyl)-1-phenylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 17148-45-7 | Molecular Weight | 276.28800 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(3-hydroxybutyl)-1-phenyl-1,3-diazinane-2,4,6-trione |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.28800 |
| Exact Mass | 276.11100 |
| PSA | 90.20000 |
| LogP | 1.38750 |
| Index of Refraction | 1.565 |
| InChIKey | RLSZRIYHPDTEIB-UHFFFAOYSA-N |
| SMILES | CC(O)CCC1C(=O)NC(=O)N(c2ccccc2)C1=O |
| HS Code | 2933540000 |
|---|
| HS Code | 2933540000 |
|---|---|
| Summary | 2933540000 other derivatives of malonylurea (barbituric acid); salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |