Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate structure
|
Common Name | Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1715230-39-9 | Molecular Weight | 237.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15N3O3 |
|---|---|
| Molecular Weight | 237.25 |
| InChIKey | SNIRWPFEQJHNLS-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CCCN(c2ncc[nH]c2=O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate? |
| A: InChIKey of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate is SNIRWPFEQJHNLS-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1715230-39-9? |
| A: Chinese name of 1715230-39-9 is 1715230-39-9. |
| Q: What is the CAS number of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate? |
| A: CAS number of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate is 1715230-39-9. |
| Q: What is the molecular weight of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate? |
| A: Molecular weight of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate is 237.25. |
| Q: What is the molecular formula of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate? |
| A: Molecular formula of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate is C11H15N3O3. |
| Q: What is the English name of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate? |
| A: The English name of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate is Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate. |
| Q: What is the SMILES notation of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate? |
| A: SMILES notation of Methyl 1-(3-oxo-3,4-dihydropyrazin-2-yl)piperidine-3-carboxylate is COC(=O)C1CCCN(c2ncc[nH]c2=O)C1. |