Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride
Modify Date: 2026-07-07 14:19:52
Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride structure
|
Common Name | Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 17159-58-9 | Molecular Weight | 403.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H26ClNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H26ClNO4 |
|---|---|
| Molecular Weight | 403.9 |
| InChIKey | RMHOGPXPFRRMFD-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OCC.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride? |
| A: Molecular formula of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride is C22H26ClNO4. |
| Q: What is the Chinese name of 17159-58-9? |
| A: Chinese name of 17159-58-9 is 17159-58-9. |
| Q: What is the molecular weight of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride? |
| A: Molecular weight of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride is 403.9. |
| Q: What is the InChIKey of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride? |
| A: InChIKey of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride is RMHOGPXPFRRMFD-UHFFFAOYSA-N. |
| Q: What is the English name of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride? |
| A: The English name of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride is Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride. |
| Q: What is the SMILES notation of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride? |
| A: SMILES notation of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride is CCOc1ccc(Cc2nccc3cc(OC)c(OC)cc23)cc1OCC.Cl. |
| Q: What is the CAS number of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride? |
| A: CAS number of Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-dimethoxy-, hydrochloride is 17159-58-9. |