Brasofensine sulfate structure
|
Common Name | Brasofensine sulfate | ||
|---|---|---|---|---|
| CAS Number | 171655-92-8 | Molecular Weight | 425.32700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H22Cl2N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Brasofensine sulfateBrasofensine (BMS-204756) sulfate is a dopamine transporter antagonist and can be used for parkinson’s disease research[1]. |
| Name | (E)-1-[(1R,3S,4R,5R)-3-(3,4-dichlorophenyl)-8-methyl-8-azabicyclo[3.2.1]octan-4-yl]-N-methoxymethanimine,sulfuric acid |
|---|
| Description | Brasofensine (BMS-204756) sulfate is a dopamine transporter antagonist and can be used for parkinson’s disease research[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50:Dopamine transporter[1] |
| References |
| Molecular Formula | C16H22Cl2N2O5S |
|---|---|
| Molecular Weight | 425.32700 |
| Exact Mass | 424.06300 |
| PSA | 107.81000 |
| LogP | 4.55780 |
| Vapour Pressure | 4.7E-07mmHg at 25°C |
| InChIKey | MOYPZNPGNIZILM-NPJZCEOMSA-N |
| SMILES | CON=CC1C(c2ccc(Cl)c(Cl)c2)CC2CCC1N2C.O=S(=O)(O)O |