6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin
Modify Date: 2026-08-23 15:05:08
6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin structure
|
Common Name | 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin | ||
|---|---|---|---|---|
| CAS Number | 171663-52-8 | Molecular Weight | 1174.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H75NO34 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C45H75NO34 |
|---|---|
| Molecular Weight | 1174.1 |
| InChIKey | RMDKBUPBUFJIDL-HCHLQLBUSA-N |
| SMILES | C=CCNCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC8C(CO)OC(OC1C(O)C2O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin? |
| A: CAS number of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin is 171663-52-8. |
| Q: What is the molecular weight of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin? |
| A: Molecular weight of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin is 1174.1. |
| Q: What is the SMILES notation of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin? |
| A: SMILES notation of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin is C=CCNCC1OC2OC3C(CO)OC(OC4C(CO)OC(OC5C(CO)OC(OC6C(CO)OC(OC7C(CO)OC(OC8C(CO)OC(OC1C(O)C2O)C(O)C8O)C(O)C7O)C(O)C6O)C(O)C5O)C(O)C4O)C(O)C3O. |
| Q: What is the English name of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin? |
| A: The English name of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin is 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin. |
| Q: What is the molecular formula of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin? |
| A: Molecular formula of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin is C45H75NO34. |
| Q: What is the InChIKey of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin? |
| A: InChIKey of 6A-Deoxy-6A-(2-propen-1-ylamino)-|A-cyclodextrin is RMDKBUPBUFJIDL-HCHLQLBUSA-N. |
| Q: What is the Chinese name of 171663-52-8? |
| A: Chinese name of 171663-52-8 is 171663-52-8. |