3-oxo-3-(3-trifluoromethylphenyl)propionic acid ethyl ester structure
|
Common Name | 3-oxo-3-(3-trifluoromethylphenyl)propionic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1717-42-6 | Molecular Weight | 260.209 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 267.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C12H11F3O3 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 111.9±20.8 °C | |
| Name | ethyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 267.2±35.0 °C at 760 mmHg |
| Molecular Formula | C12H11F3O3 |
| Molecular Weight | 260.209 |
| Flash Point | 111.9±20.8 °C |
| Exact Mass | 260.066040 |
| PSA | 43.37000 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.461 |
| InChIKey | YCHPVUWFIZXXPI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1cccc(C(F)(F)F)c1 |
| Personal Protective Equipment | Eyeshields;Gloves |
|---|---|
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2918300090 |
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| ethyl m-trifluoromethylbenzoylacetate |
| ethyl 3-(3-trifluoromethyl-phenyl)-3-oxopropanoate |
| Ethyl 3-oxo-3-[3-(trifluoromethyl)phenyl]propanoate |
| Benzenepropanoic acid, β-oxo-3-(trifluoromethyl)-, ethyl ester |
| Ethyl (3-trifluoromethylbenzoyl)acetate |
| MFCD03424819 |