Carbonic acid methylbiphenyl-4-yl ester structure
|
Common Name | Carbonic acid methylbiphenyl-4-yl ester | ||
|---|---|---|---|---|
| CAS Number | 17175-08-5 | Molecular Weight | 228.24300 | |
| Density | 1.148g/cm3 | Boiling Point | 355ºC at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 139.6ºC | |
| Name | 4-Biphenylyl methyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 355ºC at 760 mmHg |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.24300 |
| Flash Point | 139.6ºC |
| Exact Mass | 228.07900 |
| PSA | 35.53000 |
| LogP | 3.49880 |
| Vapour Pressure | 3.22E-05mmHg at 25°C |
| Index of Refraction | 1.556 |
| InChIKey | RANTWTKWHLPURZ-UHFFFAOYSA-N |
| SMILES | COC(=O)Oc1ccc(-c2ccccc2)cc1 |
| HS Code | 2920909090 |
|---|
|
~99%
Carbonic acid m... CAS#:17175-08-5 |
| Literature: Fritz-Langhals, Elke Synlett, 1999 , # 11 p. 1805 - 1807 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| biphenyl-4-yl methyl carbonate |
| biphenyl-4-yl 1-hydroxyethyl ketone |