Fmoc-Ser(Ac)-OH structure
|
Common Name | Fmoc-Ser(Ac)-OH | ||
|---|---|---|---|---|
| CAS Number | 171778-17-9 | Molecular Weight | 369.368 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 611.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C20H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 323.4±31.5 °C | |
Use of Fmoc-Ser(Ac)-OHFmoc-Ser(Ac)-OH (Fmoc-O-acetyl-L-serine) is a Serine derivative. Fmoc-Ser(Ac)-OH can be used for the preparation of broad-spectrum coronavirus membrane fusion inhibitor[1]. |
| Name | (2S)-3-acetyloxy-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-Ser(Ac)-OH (Fmoc-O-acetyl-L-serine) is a Serine derivative. Fmoc-Ser(Ac)-OH can be used for the preparation of broad-spectrum coronavirus membrane fusion inhibitor[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 611.2±55.0 °C at 760 mmHg |
| Molecular Formula | C20H19NO6 |
| Molecular Weight | 369.368 |
| Flash Point | 323.4±31.5 °C |
| Exact Mass | 369.121246 |
| PSA | 101.93000 |
| LogP | 4.13 |
| Vapour Pressure | 0.0±1.8 mmHg at 25°C |
| Index of Refraction | 1.596 |
| InChIKey | HSGIKRPBGCJRDB-SFHVURJKSA-N |
| SMILES | CC(=O)OCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| Storage condition | 2-8°C |
|
~48%
Fmoc-Ser(Ac)-OH CAS#:171778-17-9 |
| Literature: Maschauer, Simone; Pischetsrieder, Monika; Kuwert, Torsten; Prante, Olaf Journal of Labelled Compounds and Radiopharmaceuticals, 2005 , vol. 48, # 10 p. 701 - 719 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Fmoc-L-Ser(Ac) |
| Fmoc-Ser(Ac) |
| O-Acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-L-serine |
| L-Serine, O-acetyl-N-[(9H-fluoren-9-ylmethoxy)carbonyl]- |
| Fmoc-L-Serine(Ac) |
| Fmoc-(Ac)-L-serine |
| Fmoc-Ser(Ac)-OH |