6-Chloro-5-nitro-3-pyridinecarboxylic acid ethyl ester structure
|
Common Name | 6-Chloro-5-nitro-3-pyridinecarboxylic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 171876-22-5 | Molecular Weight | 230.60500 | |
| Density | 1.433 | Boiling Point | 330ºC at 760 mmHg | |
| Molecular Formula | C8H7ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.4ºC | |
| Name | ethyl 6-chloro-5-nitropyridine-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.433 |
|---|---|
| Boiling Point | 330ºC at 760 mmHg |
| Molecular Formula | C8H7ClN2O4 |
| Molecular Weight | 230.60500 |
| Flash Point | 153.4ºC |
| Exact Mass | 230.00900 |
| PSA | 85.01000 |
| LogP | 2.34310 |
| Vapour Pressure | 0.000171mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | RJGYARAKIVLQAQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(Cl)c([N+](=O)[O-])c1 |
| Storage condition | 2-8°C |
| HS Code | 2933399090 |
|---|
|
~%
6-Chloro-5-nitr... CAS#:171876-22-5 |
| Literature: WO2013/152039 A1, ; Page/Page column 167 ; |
|
~%
6-Chloro-5-nitr... CAS#:171876-22-5 |
| Literature: US2003/236251 A1, ; Page 22 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| ethyl 6-chloro-5-nitro-3-pyridinecarboxylate |
| 6-chloro-5-nitronicotinic acid ethyl ester |
| 6-Chlor-5-nitro-nicotinsaeure-aethylester |
| Ethyl 6-chloro-5-nitronicotinate |