4-(Dimethylamino)-α,α-diphenylbenzenemethanol structure
|
Common Name | 4-(Dimethylamino)-α,α-diphenylbenzenemethanol | ||
|---|---|---|---|---|
| CAS Number | 1719-05-7 | Molecular Weight | 303.39800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [4-(dimethylamino)phenyl]-diphenylmethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H21NO |
|---|---|
| Molecular Weight | 303.39800 |
| Exact Mass | 303.16200 |
| PSA | 23.47000 |
| LogP | 4.03680 |
| InChIKey | RINGMELOOTUDIA-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C(O)(c2ccccc2)c2ccccc2)cc1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| p-Dimethylaminotriphenylcarbinol |
| D&C Orange 5 Zirconium Lake |
| Sunset orange carbinol |