Ethyl 1,3,6,8-tetramethoxy-2-naphthoate structure
|
Common Name | Ethyl 1,3,6,8-tetramethoxy-2-naphthoate | ||
|---|---|---|---|---|
| CAS Number | 17213-51-3 | Molecular Weight | 320.33700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 1,3,6,8-tetramethoxynaphthalene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H20O6 |
|---|---|
| Molecular Weight | 320.33700 |
| Exact Mass | 320.12600 |
| PSA | 63.22000 |
| LogP | 3.05090 |
| InChIKey | OJBVVJORRJKHMW-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(OC)cc2cc(OC)cc(OC)c2c1OC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Naphthalenecarboxylicacid,1,3,6,8-tetramethoxy-,ethyl ester |
| Ethyl 1,3,6,8-tetramethoxy-2-naphthoate |
| 1,3,6,8-Tetramethoxy-naphthalin-2-carbonsaeure-ethylester |