7-Deaza-7-Iodo-2'-deoxyguanosine structure
|
Common Name | 7-Deaza-7-Iodo-2'-deoxyguanosine | ||
|---|---|---|---|---|
| CAS Number | 172163-62-1 | Molecular Weight | 392.150 | |
| Density | 2.5±0.1 g/cm3 | Boiling Point | 679.9±65.0 °C at 760 mmHg | |
| Molecular Formula | C11H13IN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.0±34.3 °C | |
Use of 7-Deaza-7-Iodo-2'-deoxyguanosine7-Iodo-7-deaza-2'-deoxyguanosine (7-Deaza-7-Iodo-2'-deoxyguanosine) is a deoxyguanosine derivative that can be used in DNA synthesis and sequencing reactions[1]. |
| Name | 7-iodo-7-deaza-2'-deoxyguanosine |
|---|---|
| Synonym | More Synonyms |
| Description | 7-Iodo-7-deaza-2'-deoxyguanosine (7-Deaza-7-Iodo-2'-deoxyguanosine) is a deoxyguanosine derivative that can be used in DNA synthesis and sequencing reactions[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Ronald Graham, et al. Nucleotide cleavable linkers and uses thereof. WO2020146397A1. |
| Density | 2.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 679.9±65.0 °C at 760 mmHg |
| Molecular Formula | C11H13IN4O4 |
| Molecular Weight | 392.150 |
| Flash Point | 365.0±34.3 °C |
| Exact Mass | 391.998138 |
| PSA | 126.39000 |
| LogP | 0.35 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.919 |
| InChIKey | TVQBNMOSBBMRCZ-VQVTYTSYSA-N |
| SMILES | Nc1nc2c(c(I)cn2C2CC(O)C(CO)O2)c(=O)[nH]1 |
| Storage condition | 2-8℃ |
| 7-Deaza-7-I-2'-dG |
| 4H-Pyrrolo[2,3-d]pyrimidin-4-one, 2-amino-7-(2-deoxy-β-D-erythro-pentofuranosyl)-1,7-dihydro-5-iodo- |
| 2-Amino-7-(2-deoxy-β-D-erythro-pentofuranosyl)-5-iodo-1,7-dihydro-4H-pyrrolo[2,3-d]pyrimidin-4-one |
| 2-Amino-7-((2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)-5-iodo-1H-pyrrolo[2,3-d]pyrimidin-4(7H)-one |
| 7-Deaza-7-Iodo deoxy Guanosine |
| 7-DEAZA-2'-DEOXY-7-IODOGUANOSINE |
| 7-DEAZA-7-IODO-2'-DEOXYGUANOSINE |