3-Quinolinecarboxylicacid, 7-(diethylamino)-4-hydroxy-6-propyl-, methyl ester structure
|
Common Name | 3-Quinolinecarboxylicacid, 7-(diethylamino)-4-hydroxy-6-propyl-, methyl ester | ||
|---|---|---|---|---|
| CAS Number | 17230-85-2 | Molecular Weight | 316.39500 | |
| Density | 1.138g/cm3 | Boiling Point | 472.6ºC at 760mmHg | |
| Molecular Formula | C18H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.6ºC | |
| Name | methyl 7-(diethylamino)-4-oxo-6-propyl-1H-quinoline-3-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.138g/cm3 |
|---|---|
| Boiling Point | 472.6ºC at 760mmHg |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.39500 |
| Flash Point | 239.6ºC |
| Exact Mass | 316.17900 |
| PSA | 62.66000 |
| LogP | 3.52570 |
| Vapour Pressure | 4.21E-09mmHg at 25°C |
| Index of Refraction | 1.562 |
| InChIKey | NMYCTBARPUAEQN-UHFFFAOYSA-N |
| SMILES | CCCc1cc2c(=O)c(C(=O)OC)c[nH]c2cc1N(CC)CC |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Amquinate (USAN/INN) |
| AMQUINATE |
| Amquinolate |
| Amquinato |
| Amquinatum [INN-Latin] |
| Amquinatum |
| Amquinato [INN-Spanish] |