Bicyclo[2.2.1]heptane-2,3-dicarboxylicacid structure
|
Common Name | Bicyclo[2.2.1]heptane-2,3-dicarboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 1724-08-9 | Molecular Weight | 184.18900 | |
| Density | 1.42g/cm3 | Boiling Point | 407.7ºC at 760mmHg | |
| Molecular Formula | C9H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 214.5ºC | |
| Name | 2,3-Norbornanedicarboxylic Acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 407.7ºC at 760mmHg |
| Molecular Formula | C9H12O4 |
| Molecular Weight | 184.18900 |
| Flash Point | 214.5ºC |
| Exact Mass | 184.07400 |
| PSA | 74.60000 |
| LogP | 0.81790 |
| Vapour Pressure | 8.65E-08mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | IVVOCRBADNIWDM-UHFFFAOYSA-N |
| SMILES | O=C(O)C1C2CCC(C2)C1C(=O)O |
| HS Code | 2917209090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917209090 |
|---|---|
| Summary | 2917209090 other cyclanic, cyclenic or cyclotherpenic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| 2,3-NORBORNANEDICARBOXYLIC ACID |
| Norbornan-2endo,3exo-dicarbonsaeure |
| norbornane-2,3-dicarboxylic acid |
| Bicyclo[2.2.1]heptane-2,3-dicarboxylic Acid |