ethyl 4-(3,5-dimethylphenyl)sulfanyl-5-ethyl-6-methyl-2-oxo-1H-pyridine-3-carboxylate structure
|
Common Name | ethyl 4-(3,5-dimethylphenyl)sulfanyl-5-ethyl-6-methyl-2-oxo-1H-pyridine-3-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 172469-91-9 | Molecular Weight | 345.45600 | |
| Density | 1.18g/cm3 | Boiling Point | 496.4ºC at 760 mmHg | |
| Molecular Formula | C19H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254ºC | |
| Name | ethyl 4-(3,5-dimethylphenyl)sulfanyl-5-ethyl-6-methyl-2-oxo-1H-pyridine-3-carboxylate |
|---|
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 496.4ºC at 760 mmHg |
| Molecular Formula | C19H23NO3S |
| Molecular Weight | 345.45600 |
| Flash Point | 254ºC |
| Exact Mass | 345.14000 |
| PSA | 84.72000 |
| LogP | 4.60270 |
| Vapour Pressure | 5.44E-10mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | HDCVUVBODUPMJA-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(Sc2cc(C)cc(C)c2)c(CC)c(C)[nH]c1=O |
|
~%
ethyl 4-(3,5-di... CAS#:172469-91-9 |
| Literature: Dolle; Fan; Chi Hung Nguyen; Aubertin; Kirn; Andreola; Jamieson; Tarrago-Litvak; Bisagni Journal of Medicinal Chemistry, 1995 , vol. 38, # 23 p. 4679 - 4686 |
|
~80%
ethyl 4-(3,5-di... CAS#:172469-91-9 |
| Literature: Dolle; Fan; Chi Hung Nguyen; Aubertin; Kirn; Andreola; Jamieson; Tarrago-Litvak; Bisagni Journal of Medicinal Chemistry, 1995 , vol. 38, # 23 p. 4679 - 4686 |