2-(difluoromethylene)-4,4,5-trifluoro-5-(trifluoromethyl)-1,3-dioxolane structure
|
Common Name | 2-(difluoromethylene)-4,4,5-trifluoro-5-(trifluoromethyl)-1,3-dioxolane | ||
|---|---|---|---|---|
| CAS Number | 17256-52-9 | Molecular Weight | 244.04000 | |
| Density | 1.72g/cm3 | Boiling Point | 1.7ºC at 760mmHg | |
| Molecular Formula | C5F8O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(difluoromethylene)-4,4,5-trifluoro-5-(trifluoromethyl)-1,3-dioxolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.72g/cm3 |
|---|---|
| Boiling Point | 1.7ºC at 760mmHg |
| Molecular Formula | C5F8O2 |
| Molecular Weight | 244.04000 |
| Exact Mass | 243.97700 |
| PSA | 18.46000 |
| LogP | 2.91970 |
| Vapour Pressure | 1710mmHg at 25°C |
| Index of Refraction | 1.307 |
| InChIKey | RFJVDJWCXSPUBY-UHFFFAOYSA-N |
| SMILES | FC(F)=C1OC(F)(F)C(F)(C(F)(F)F)O1 |
| HS Code | 2932999099 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Einecs 241-290-0 |
| 2-(Difluoromethylene)-4-(trifluoromethyl)-4,5,5-trifluoro-1,3-dioxolane |
| perfluoro-2-methylene-2-methyl-1,3-dioxolane |
| 1,3-Dioxolane,2-(difluoromethylene)-4,4,5-trifluoro-5-(trifluoromethyl) |
| perfluoro-4-methyl-2-methylene-1,3-dioxolane |
| perfluoro(2-methylene-4-methyl-1,3-dioxolane) |