IGF1Rtide structure
|
Common Name | IGF1Rtide | ||
|---|---|---|---|---|
| CAS Number | 172615-51-9 | Molecular Weight | 1595.79000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C73H114N18O22 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of IGF1RtideIGF1Rtide can be used as a RET kinase substrate for RET kinase assays[1]. |
| Name | h-lys-lys-lys-ser-pro-gly-glu-tyr-val-asn-ile-glu-phe-gly-oh |
|---|---|
| Synonym | More Synonyms |
| Description | IGF1Rtide can be used as a RET kinase substrate for RET kinase assays[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C73H114N18O22 |
|---|---|
| Molecular Weight | 1595.79000 |
| Exact Mass | 1594.84000 |
| PSA | 669.04000 |
| LogP | 2.47730 |
| InChIKey | KVGQVWWLDJKNMP-UHFFFAOYSA-N |
| SMILES | CCC(C)C(NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)C(CCC(=O)O)NC(=O)CNC(=O)C1CCCN1C(=O)C(CO)NC(=O)C(CCCCN)NC(=O)C(CCCCN)NC(=O)C(N)CCCCN)C(C)C)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NCC(=O)O |
| igf1rk peptide substrate |