Pt(II) Octaethylporphine ketone structure
|
Common Name | Pt(II) Octaethylporphine ketone | ||
|---|---|---|---|---|
| CAS Number | 172617-46-8 | Molecular Weight | 743.83900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H44N4OPt | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Pt(II) Octaethylporphine ketonePt(II) Octaethylporphine ketone is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | [3,3,7,8,12,13,17,18-Octaethyl-2(3H)-porphyrinonato(2-)-κ2N,N']platinum |
|---|
| Description | Pt(II) Octaethylporphine ketone is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Molecular Formula | C36H44N4OPt |
|---|---|
| Molecular Weight | 743.83900 |
| Exact Mass | 743.31600 |
| PSA | 73.03000 |
| LogP | 5.46080 |
| InChIKey | DKPOGYJJFLIBKP-UHFFFAOYSA-M |
| SMILES | CCC1=C(CC)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(CC)c5CC)C(=O)C4(CC)CC)c(CC)c3CC.[Pt+2] |