triphenylstannyl but-2-enoate
Modify Date: 2025-09-11 18:02:06
triphenylstannyl but-2-enoate structure
|
Common Name | triphenylstannyl but-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 172649-14-8 | Molecular Weight | 435.09400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H20O2Sn | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenylstannyl but-2-enoate |
|---|
| Molecular Formula | C22H20O2Sn |
|---|---|
| Molecular Weight | 435.09400 |
| Exact Mass | 436.04900 |
| PSA | 40.13000 |
| LogP | 3.39200 |
| InChIKey | FNHVGGKZZBFQCH-UHFFFAOYSA-M |
| SMILES | CC=CC(=O)O[Sn](c1ccccc1)(c1ccccc1)c1ccccc1 |
|
~30%
triphenylstanny... CAS#:172649-14-8 |
| Literature: Shi; Nicholas Journal of the American Chemical Society, 1997 , vol. 119, # 21 p. 5057 - 5058 |
