ZD-0947 structure
|
Common Name | ZD-0947 | ||
|---|---|---|---|---|
| CAS Number | 172649-40-0 | Molecular Weight | 318.29300 | |
| Density | 1.365g/cm3 | Boiling Point | 420.402ºC at 760 mmHg | |
| Molecular Formula | C17H13F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 208.052ºC | |
Use of ZD-0947ZD-0947, also known as AZD-0947, is a K(ATP) channel activator potentially for the treatment of overactive bladder (OAB). |
| Name | 3-[(4S)-5-oxo-2-(trifluoromethyl)-4,6,7,8-tetrahydro-1H-quinolin-4-yl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.365g/cm3 |
|---|---|
| Boiling Point | 420.402ºC at 760 mmHg |
| Molecular Formula | C17H13F3N2O |
| Molecular Weight | 318.29300 |
| Flash Point | 208.052ºC |
| Exact Mass | 318.09800 |
| PSA | 52.89000 |
| LogP | 4.02718 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | RUVMMEREJMHLOS-LBPRGKRZSA-N |
| SMILES | N#Cc1cccc(C2C=C(C(F)(F)F)NC3=C2C(=O)CCC3)c1 |
| HS Code | 2933499090 |
|---|
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| zd0947 |