4-Biphenylyl diphenyl phosphate structure
|
Common Name | 4-Biphenylyl diphenyl phosphate | ||
|---|---|---|---|---|
| CAS Number | 17269-99-7 | Molecular Weight | 402.379 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 488.9±24.0 °C at 760 mmHg | |
| Molecular Formula | C24H19O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.6±43.2 °C | |
| Name | 4-Biphenylol diphenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.9±24.0 °C at 760 mmHg |
| Molecular Formula | C24H19O4P |
| Molecular Weight | 402.379 |
| Flash Point | 262.6±43.2 °C |
| Exact Mass | 402.102081 |
| PSA | 54.57000 |
| LogP | 5.85 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.612 |
| InChIKey | YHTCUUPQEPBRRC-UHFFFAOYSA-N |
| SMILES | O=P(Oc1ccccc1)(Oc1ccccc1)Oc1ccc(-c2ccccc2)cc1 |
| HS Code | 2919900090 |
|---|
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phosphoric acid, diphenyl 1,1'-biphenyl-4-yl ester |
| [1,1'-Biphenyl]-4-yl diphenyl phosphate |
| Phosphoric acid, [1,1'-biphenyl]-4-yl diphenyl ester |
| Phosphorsaeure-biphenyl-4-ylester-diphenylester |
| Biphenyl-2-yl-diphenyl-phosphat |
| 4-Biphenylyl diphenyl phosphate |
| phosphoric acid biphenyl-4-yl ester-diphenyl ester |