Benzamide,3,4-dichloro-N,N-bis(1-methylethyl)- structure
|
Common Name | Benzamide,3,4-dichloro-N,N-bis(1-methylethyl)- | ||
|---|---|---|---|---|
| CAS Number | 17271-13-5 | Molecular Weight | 274.18600 | |
| Density | 1.164g/cm3 | Boiling Point | 387.2ºC at 760mmHg | |
| Molecular Formula | C13H17Cl2NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188ºC | |
| Name | 3,4-dichloro-N,N-di(propan-2-yl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.164g/cm3 |
|---|---|
| Boiling Point | 387.2ºC at 760mmHg |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.18600 |
| Flash Point | 188ºC |
| Exact Mass | 273.06900 |
| PSA | 20.31000 |
| LogP | 4.25240 |
| Vapour Pressure | 3.36E-06mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | UNOSTPUGMODIOA-UHFFFAOYSA-N |
| SMILES | CC(C)N(C(=O)c1ccc(Cl)c(Cl)c1)C(C)C |
|
~66%
Benzamide,3,4-d... CAS#:17271-13-5 |
| Literature: Dong, Chang-Zhi; Julia, Marc; Tang, Jie European Journal of Organic Chemistry, 1998 , # 8 p. 1689 - 1696 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3,4-dichloro-N,N-diisopropylbenzamide |
| 3,4-Dichlor-benzoesaeure-diisopropylamid |
| (3,4-dichlorophenyl)-N,N-bis(methylethyl)carboxamide |