N-(1-benzyl-4-phenylpiperidin-4-yl)acetamide structure
|
Common Name | N-(1-benzyl-4-phenylpiperidin-4-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 172733-78-7 | Molecular Weight | 308.41700 | |
| Density | 1.127g/cm3 | Boiling Point | 491.59ºC at 760 mmHg | |
| Molecular Formula | C20H24N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.105ºC | |
| Name | N-(1-benzyl-4-phenylpiperidin-4-yl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.127g/cm3 |
|---|---|
| Boiling Point | 491.59ºC at 760 mmHg |
| Molecular Formula | C20H24N2O |
| Molecular Weight | 308.41700 |
| Flash Point | 251.105ºC |
| Exact Mass | 308.18900 |
| PSA | 35.83000 |
| LogP | 4.09220 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.604 |
| InChIKey | JZIHXLNGPVLLDT-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1(c2ccccc2)CCN(Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 4 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Acetamido-1-benzyl-4-phenylpiperidine |