N-Boc-4-aminopentanoic Acid structure
|
Common Name | N-Boc-4-aminopentanoic Acid | ||
|---|---|---|---|---|
| CAS Number | 172833-22-6 | Molecular Weight | 217.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H19NO4 |
|---|---|
| Molecular Weight | 217.26200 |
| Exact Mass | 217.13100 |
| PSA | 79.12000 |
| LogP | 1.96880 |
| InChIKey | CVYVXURBKURNKE-UHFFFAOYSA-N |
| SMILES | CC(CCC(=O)O)NC(=O)OC(C)(C)C |
|
~%
N-Boc-4-aminope... CAS#:172833-22-6 |
| Literature: Lim, Jongwon; Stock, Nicholas; Pracitto, Richard; Boueres, Julia K.; Munoz, Benito; Chaudhary, Ashok; Santini, Angelina M.; Orr, Karia; Schaffhauser, Herve; Bezverkov, Robert E.; Aiyar, Jayashree; Venkatraman, Shankar Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 8 p. 1913 - 1916 |
|
~%
N-Boc-4-aminope... CAS#:172833-22-6 |
| Literature: Lim, Jongwon; Stock, Nicholas; Pracitto, Richard; Boueres, Julia K.; Munoz, Benito; Chaudhary, Ashok; Santini, Angelina M.; Orr, Karia; Schaffhauser, Herve; Bezverkov, Robert E.; Aiyar, Jayashree; Venkatraman, Shankar Bioorganic and Medicinal Chemistry Letters, 2004 , vol. 14, # 8 p. 1913 - 1916 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-N-Boc-aminovaleric acid |
| N-Boc-4-aminopentanoic Acid |
| 4-N-Boc-aminovalerate |