Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester
Modify Date: 2026-06-26 11:07:00
Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester structure
|
Common Name | Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester | ||
|---|---|---|---|---|
| CAS Number | 172926-98-6 | Molecular Weight | 436.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H44O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H44O5 |
|---|---|
| Molecular Weight | 436.6 |
| InChIKey | HRDMQXHVDZIOGQ-DFBDJOIZSA-N |
| SMILES | CCCCCCCC/C=C\CCCCCCC/C=C\1/CC(OC1=O)(CO)COC(=O)C |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Displacement of phorbol 12,13-dibutyrate (PDBU) from Protein kinase C alpha
Source: ChEMBL
Target: Protein kinase C alpha type
External Id: CHEMBL766778
|
|
Name: Affinity for protein kinase-C alpha (PK-C alpha)
Source: ChEMBL
Target: Protein kinase C alpha type
External Id: CHEMBL769620
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester? |
| A: CAS number of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester is 172926-98-6. |
| Q: What is the SMILES notation of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester? |
| A: SMILES notation of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester is CCCCCCCC/C=C\CCCCCCC/C=C\1/CC(OC1=O)(CO)COC(=O)C. |
| Q: What is the InChIKey of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester? |
| A: InChIKey of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester is HRDMQXHVDZIOGQ-DFBDJOIZSA-N. |
| Q: What is the English name of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester? |
| A: The English name of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester is Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester. |
| Q: What is the molecular formula of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester? |
| A: Molecular formula of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester is C26H44O5. |
| Q: What is the Chinese name of 172926-98-6? |
| A: Chinese name of 172926-98-6 is 172926-98-6. |
| Q: What is the molecular weight of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester? |
| A: Molecular weight of Acetic acid 2-hydroxymethyl-4-octadec-9-enylidene-5-oxo-tetrahydro-furan-2-ylmethyl ester is 436.6. |