((Cys31,Nva34)-Neuropeptide Y (27-36))2 structure
|
Common Name | ((Cys31,Nva34)-Neuropeptide Y (27-36))2 | ||
|---|---|---|---|---|
| CAS Number | 172997-92-1 | Molecular Weight | 2597.07000 | |
| Density | 1.5±0.1g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C116H186N36O28S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | bwx 46 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1g/cm3 |
|---|---|
| Molecular Formula | C116H186N36O28S2 |
| Molecular Weight | 2597.07000 |
| Exact Mass | 2595.37000 |
| PSA | 1167.78000 |
| LogP | 7.86440 |
| Index of Refraction | 1.667 |
| InChIKey | NCCWKDKNIQUYAI-JULUKTQUSA-N |
| SMILES | CCCC(NC(=O)C(CCCNC(=N)N)NC(=O)C(NC(=O)C(CSSCC(NC(=O)C(CC(C)C)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)Cc1ccc(O)cc1)C(C)CC)C(=O)NC(C(=O)NC(CCCNC(=N)N)C(=O)NC(CCC)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1ccc(O)cc1)C(N)=O)C(C)O)NC(=O)C(CC(C)C)NC(=O)C(CC(N)=O)NC(=O)C(NC(=O)C(N)Cc1ccc(O)cc1)C(C)CC)C(C)O)C(=O)NC(CCCNC(=N)N)C(=O)NC(Cc1ccc(O)cc1)C(N)=O |
| Water Solubility | Soluble to 10 mg/ml in water |
| Licarbazepine |
| ((CYS31,NVA34)-NEUROPEPTIDE Y (27-36))2 |