2-[ethoxy(phenyl)phosphinothioyl]oxybenzonitrile structure
|
Common Name | 2-[ethoxy(phenyl)phosphinothioyl]oxybenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 17313-31-4 | Molecular Weight | 303.31600 | |
| Density | 1.26g/cm3 | Boiling Point | 427.9ºC at 760 mmHg | |
| Molecular Formula | C15H14NO2PS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.6ºC | |
| Name | 2-[ethoxy(phenyl)phosphinothioyl]oxybenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 427.9ºC at 760 mmHg |
| Molecular Formula | C15H14NO2PS |
| Molecular Weight | 303.31600 |
| Flash Point | 212.6ºC |
| Exact Mass | 303.04800 |
| PSA | 84.15000 |
| LogP | 4.25918 |
| Vapour Pressure | 1.58E-07mmHg at 25°C |
| Index of Refraction | 1.606 |
| InChIKey | JRBNVSUWXMKKRT-UHFFFAOYSA-N |
| SMILES | CCOP(=S)(Oc1ccccc1C#N)c1ccccc1 |
| Phosphonothioic acid,phenyl-,O-ethyl ester,O-ester with o-hydroxybenzonitrile |
| Phenylphosphonothioic O-ethyl ester O-ester with o-hydroxybenzonitrile |
| O-(2-cyanophenyl) O-ethyl phenylphosphonothioate |
| O-Aethyl-O-(2-cyan-phenyl)-phenyl-thiophosphorsaeure |