2-(5-NITRO-1H-1,2,4-TRIAZOL-3-YL)ACETIC ACID structure
|
Common Name | 2-(5-NITRO-1H-1,2,4-TRIAZOL-3-YL)ACETIC ACID | ||
|---|---|---|---|---|
| CAS Number | 173167-32-3 | Molecular Weight | 172.09900 | |
| Density | 1.84g/cm3 | Boiling Point | 595.7ºC at 760 mmHg | |
| Molecular Formula | C4H4N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 314.1ºC | |
| Name | 2-(3-nitro-1H-1,2,4-triazol-5-yl)acetic acid |
|---|
| Density | 1.84g/cm3 |
|---|---|
| Boiling Point | 595.7ºC at 760 mmHg |
| Molecular Formula | C4H4N4O4 |
| Molecular Weight | 172.09900 |
| Flash Point | 314.1ºC |
| Exact Mass | 172.02300 |
| PSA | 124.69000 |
| Vapour Pressure | 4.86E-15mmHg at 25°C |
| Index of Refraction | 1.66 |
| InChIKey | PCLPZHBFAXIPQV-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1n[nH]c([N+](=O)[O-])n1 |
|
~70%
2-(5-NITRO-1H-1... CAS#:173167-32-3 |
| Literature: Thottempudi, Venugopal; Shreeve, Jean'Ne M. Journal of the American Chemical Society, 2011 , vol. 133, # 49 p. 19982 - 19992 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |