1-nitropyrene-8-ol
Modify Date: 2025-08-31 17:29:20
1-nitropyrene-8-ol structure
|
Common Name | 1-nitropyrene-8-ol | ||
|---|---|---|---|---|
| CAS Number | 1732-29-2 | Molecular Weight | 263.24800 | |
| Density | 1.528g/cm3 | Boiling Point | 509.7ºC at 760mmHg | |
| Molecular Formula | C16H9NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.3ºC | |
| Name | 8-nitropyren-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.528g/cm3 |
|---|---|
| Boiling Point | 509.7ºC at 760mmHg |
| Molecular Formula | C16H9NO3 |
| Molecular Weight | 263.24800 |
| Flash Point | 218.3ºC |
| Exact Mass | 263.05800 |
| PSA | 66.05000 |
| LogP | 4.72100 |
| Vapour Pressure | 5.2E-11mmHg at 25°C |
| Index of Refraction | 1.912 |
| InChIKey | RHXGKMNLLUKFLG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc2ccc3ccc(O)c4ccc1c2c34 |
| HS Code | 2907199090 |
|---|
| HS Code | 2907199090 |
|---|---|
| Summary | 2907199090 other monophenols VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
|
Name: Mutagenic activity in an Ames test on Salmonella Typhimurium TA98; Activity is log of...
Source: ChEMBL
Target: Salmonella enterica subsp. enterica serovar Typhimurium
External Id: CHEMBL799656
|
Total 2, Current Page 1 of 1
1
| 1-Nitro-8-hydroxypyrene |
| Pyren-8-ol,1-nitro |
| 1-hydroxy-8-nitropyrene |
| 1-Pyrenol,8-nitro |
| 1-Nitropyrene-8-ol |
| 1-Nitropyren-8-ol |
| 8-Hydroxy-1-nitropyrene |