1,1,2,2-Ethenetetracarboxylicacid, 1,1,2,2-tetramethyl ester structure
|
Common Name | 1,1,2,2-Ethenetetracarboxylicacid, 1,1,2,2-tetramethyl ester | ||
|---|---|---|---|---|
| CAS Number | 1733-15-9 | Molecular Weight | 260.19700 | |
| Density | 1.296g/cm3 | Boiling Point | 252.1ºC at 760 mmHg | |
| Molecular Formula | C10H12O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.9ºC | |
| Name | tetramethyl ethene-1,1,2,2-tetracarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.296g/cm3 |
|---|---|
| Boiling Point | 252.1ºC at 760 mmHg |
| Molecular Formula | C10H12O8 |
| Molecular Weight | 260.19700 |
| Flash Point | 101.9ºC |
| Exact Mass | 260.05300 |
| PSA | 105.20000 |
| Vapour Pressure | 0.0197mmHg at 25°C |
| Index of Refraction | 1.462 |
| InChIKey | NPBUMSUYCUWTSF-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)=C(C(=O)OC)C(=O)OC |
| HS Code | 2917190090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 2 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| EINECS 217-065-8 |
| tetramethylethylentetracarboxylate |
| tetramethyl ethene tetracarboxylate |
| tetramethylethylenetetracarboxylate |
| Tetramethoxycarbonylethylene |
| tetracarbomethoxyethene |
| ethenetetracarboxylic acid tetramethyl ester |