N2-DMF-dG structure
|
Common Name | N2-DMF-dG | ||
|---|---|---|---|---|
| CAS Number | 17331-13-4 | Molecular Weight | 322.32000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H18N6O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N'-[9-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-6-oxo-3H-purin-2-yl]-N,N-dimethylmethanimidamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H18N6O4 |
|---|---|
| Molecular Weight | 322.32000 |
| Exact Mass | 322.13900 |
| PSA | 129.12000 |
| InChIKey | ZXECVVVXPHBGGX-DJLDLDEBSA-N |
| SMILES | CN(C)C=Nc1nc2c(ncn2C2CC(O)C(CO)O2)c(=O)[nH]1 |
|
~10%
N2-DMF-dG CAS#:17331-13-4 |
| Literature: Journal of the American Chemical Society, , vol. 133, # 50 p. 20357 - 20368 |
| N2-dimethylaminomethylene-2'-deoxyguanosine |
| 2-Dimethylaminomethylene-2'-deoxyguanosine |
| N2-dimethylformamidine-2'-deoxyguanosine |
| N2-DMF-dG |