Isorhamnetin 3-glucoside-7-rhamnoside structure
|
Common Name | Isorhamnetin 3-glucoside-7-rhamnoside | ||
|---|---|---|---|---|
| CAS Number | 17331-71-4 | Molecular Weight | 412.646 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 525.2±30.0 °C at 760 mmHg | |
| Molecular Formula | C25H48O4 | Melting Point | 222-224 °C | |
| MSDS | N/A | Flash Point | 161.9±18.1 °C | |
Use of Isorhamnetin 3-glucoside-7-rhamnosideIsorhamnetin 3-glucoside-7-rhamnoside (Luteoside) is a flavonoid that can be isolated from the aerial parts of B. tripartita[1]. |
| Name | 2-(3,4-dimethoxyphenyl)-5-hydroxy-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-7-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxychromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Isorhamnetin 3-glucoside-7-rhamnoside (Luteoside) is a flavonoid that can be isolated from the aerial parts of B. tripartita[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 525.2±30.0 °C at 760 mmHg |
| Melting Point | 222-224 °C |
| Molecular Formula | C25H48O4 |
| Molecular Weight | 412.646 |
| Flash Point | 161.9±18.1 °C |
| Exact Mass | 412.355255 |
| PSA | 66.76000 |
| LogP | 8.84 |
| Vapour Pressure | 0.0±3.1 mmHg at 25°C |
| Index of Refraction | 1.478 |
| InChIKey | NEJKEXUJCSYMCC-PXBUXKMDSA-N |
| SMILES | COc1cc(-c2oc3cc(OC4OC(C)C(O)C(O)C4O)cc(O)c3c(=O)c2OC2OC(CO)C(O)C(O)C2O)ccc1O |
| UNII-CGK541R25K |
| 2,3-Dihydroxypropyl (13E)-13-docosenoate |
| Boldoside |
| Isorhamnetin 3-glucoside-7-rhamnoside |
| Isorhamnetin 7-rhamnoside |
| Luteoside |