Z-Gly-Ala-NH2 structure
|
Common Name | Z-Gly-Ala-NH2 | ||
|---|---|---|---|---|
| CAS Number | 17331-79-2 | Molecular Weight | 279.29200 | |
| Density | 1.245g/cm3 | Boiling Point | 598.6ºC at 760mmHg | |
| Molecular Formula | C13H17N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.8ºC | |
| Name | benzyl N-[2-[(1-amino-1-oxopropan-2-yl)amino]-2-oxoethyl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.245g/cm3 |
|---|---|
| Boiling Point | 598.6ºC at 760mmHg |
| Molecular Formula | C13H17N3O4 |
| Molecular Weight | 279.29200 |
| Flash Point | 315.8ºC |
| Exact Mass | 279.12200 |
| PSA | 110.52000 |
| LogP | 1.38490 |
| Vapour Pressure | 2.72E-14mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | ZUUYPZVICLRSKZ-UHFFFAOYSA-N |
| SMILES | CC(NC(=O)CNC(=O)OCc1ccccc1)C(N)=O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-benzoyloxycarbonylglycyl-L-alaninamide |