2-[(3-chloro-2-methyl-phenyl)carbamoyl]benzoic acid structure
|
Common Name | 2-[(3-chloro-2-methyl-phenyl)carbamoyl]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 17332-26-2 | Molecular Weight | 289.71400 | |
| Density | 1.385g/cm3 | Boiling Point | 390.7ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.1ºC | |
| Name | 2-[(3-chloro-2-methylphenyl)carbamoyl]benzoic acid |
|---|
| Density | 1.385g/cm3 |
|---|---|
| Boiling Point | 390.7ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.71400 |
| Flash Point | 190.1ºC |
| Exact Mass | 289.05100 |
| PSA | 66.40000 |
| LogP | 3.67190 |
| Vapour Pressure | 8.37E-07mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | GQCLHBMPPLQYMC-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)cccc1NC(=O)c1ccccc1C(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |