2-((3,4-dimethylanilino)carbonyl)benzoic acid structure
|
Common Name | 2-((3,4-dimethylanilino)carbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 17332-48-8 | Molecular Weight | 269.29500 | |
| Density | 1.262g/cm3 | Boiling Point | 388.5ºC at 760 mmHg | |
| Molecular Formula | C16H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.7ºC | |
| Name | 2-[(3,4-dimethylphenyl)carbamoyl]benzoic acid |
|---|
| Density | 1.262g/cm3 |
|---|---|
| Boiling Point | 388.5ºC at 760 mmHg |
| Molecular Formula | C16H15NO3 |
| Molecular Weight | 269.29500 |
| Flash Point | 188.7ºC |
| Exact Mass | 269.10500 |
| PSA | 66.40000 |
| LogP | 3.32690 |
| Vapour Pressure | 9.9E-07mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | DBKSCNINEZDXAU-UHFFFAOYSA-N |
| SMILES | Cc1ccc(NC(=O)c2ccccc2C(=O)O)cc1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |