benzyl N-[1-[(1-carbamoyl-2-phenyl-ethyl)carbamoyl]butyl]carbamate structure
|
Common Name | benzyl N-[1-[(1-carbamoyl-2-phenyl-ethyl)carbamoyl]butyl]carbamate | ||
|---|---|---|---|---|
| CAS Number | 17337-71-2 | Molecular Weight | 397.46700 | |
| Density | 1.187g/cm3 | Boiling Point | 687.1ºC at 760 mmHg | |
| Molecular Formula | C22H27N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.3ºC | |
| Name | benzyl N-[1-[(1-amino-1-oxo-3-phenylpropan-2-yl)amino]-1-oxopentan-2-yl]carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.187g/cm3 |
|---|---|
| Boiling Point | 687.1ºC at 760 mmHg |
| Molecular Formula | C22H27N3O4 |
| Molecular Weight | 397.46700 |
| Flash Point | 369.3ºC |
| Exact Mass | 397.20000 |
| PSA | 110.52000 |
| LogP | 3.77640 |
| Vapour Pressure | 9.92E-19mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | GIKKFYSYHXJPJI-UHFFFAOYSA-N |
| SMILES | CCCC(NC(=O)OCc1ccccc1)C(=O)NC(Cc1ccccc1)C(N)=O |
|
~%
benzyl N-[1-[(1... CAS#:17337-71-2 |
| Literature: Gregory,H. et al. Journal of the Chemical Society [Section] C: Organic, 1968 , p. 715 - 725 |
|
~%
benzyl N-[1-[(1... CAS#:17337-71-2 |
| Literature: Gregory,H. et al. Journal of the Chemical Society [Section] C: Organic, 1968 , p. 715 - 725 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-Benzyloxycarbonyl-L-norvalyl-Phe-amid |
| BENZYL N-[1-[(1-CARBAMOYL-2-PHENYL-ETHYL)CARBAMOYL]BUTYL]CARBAMATE |