H-Gly-Gly-Glu-OH structure
|
Common Name | H-Gly-Gly-Glu-OH | ||
|---|---|---|---|---|
| CAS Number | 17343-05-4 | Molecular Weight | 261.23200 | |
| Density | 1.433g/cm3 | Boiling Point | 701.2ºC at 760mmHg | |
| Molecular Formula | C9H15N3O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 377.8ºC | |
| Name | 2-[[2-[(2-aminoacetyl)amino]acetyl]amino]pentanedioic acid |
|---|
| Density | 1.433g/cm3 |
|---|---|
| Boiling Point | 701.2ºC at 760mmHg |
| Molecular Formula | C9H15N3O6 |
| Molecular Weight | 261.23200 |
| Flash Point | 377.8ºC |
| Exact Mass | 261.09600 |
| PSA | 158.82000 |
| Vapour Pressure | 1.6E-21mmHg at 25°C |
| Index of Refraction | 1.544 |
| InChIKey | GDOZQTNZPCUARW-UHFFFAOYSA-N |
| SMILES | NCC(=O)NCC(=O)NC(CCC(=O)O)C(=O)O |
| HS Code | 2924199090 |
|---|
| HS Code | 2924199090 |
|---|---|
| Summary | 2924199090. other acyclic amides (including acyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |