H-Gly-Gly-Tyr-OH structure
|
Common Name | H-Gly-Gly-Tyr-OH | ||
|---|---|---|---|---|
| CAS Number | 17343-07-6 | Molecular Weight | 295.29100 | |
| Density | 1.381 g/cm3 | Boiling Point | 720.2ºC at 760 mmHg | |
| Molecular Formula | C13H17N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 389.4ºC | |
| Name | Glycylglycyl-L-tyrosine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.381 g/cm3 |
|---|---|
| Boiling Point | 720.2ºC at 760 mmHg |
| Molecular Formula | C13H17N3O5 |
| Molecular Weight | 295.29100 |
| Flash Point | 389.4ºC |
| Exact Mass | 295.11700 |
| PSA | 141.75000 |
| LogP | 0.06110 |
| Vapour Pressure | 9.02E-22mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | INLIXXRWNUKVCF-JTQLQIEISA-N |
| SMILES | NCC(=O)NCC(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| HS Code | 2924299090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2S)-2-[[2-[(2-aminoacetyl)amino]acetyl]amino]-3-(4-hydroxyphenyl)propanoic acid |