N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine
Modify Date: 2025-11-02 14:50:53
![N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine Structure](https://www.chemsrc.com/extcaspic/159/173458-85-0.png)
N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine structure
|
Common Name | N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine | ||
|---|---|---|---|---|
| CAS Number | 173458-85-0 | Molecular Weight | 346.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H19FN4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H19FN4 |
|---|---|
| Molecular Weight | 346.4 |
| InChIKey | MPQUHCNWQFQYFT-UHFFFAOYSA-N |
| SMILES | Cc1c(C)n(Cc2ccccc2)c2ncnc(Nc3cccc(F)c3)c12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine? |
| A: Molecular formula of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is C21H19FN4. |
| Q: What is the molecular weight of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine? |
| A: Molecular weight of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is 346.4. |
| Q: What is the InChIKey of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine? |
| A: InChIKey of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is MPQUHCNWQFQYFT-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine? |
| A: SMILES notation of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is Cc1c(C)n(Cc2ccccc2)c2ncnc(Nc3cccc(F)c3)c12. |
| Q: What is the CAS number of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine? |
| A: CAS number of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is 173458-85-0. |
| Q: What is the English name of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine? |
| A: The English name of N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine is N-(3-Fluorophenyl)-5,6-dimethyl-7-(phenylmethyl)-7H-pyrrolo[2,3-d]pyrimidin-4-amine. |
| Q: What is the Chinese name of 173458-85-0? |
| A: Chinese name of 173458-85-0 is 173458-85-0. |